Senin, 20 Juli 2009

Soal Kimia Karbon

MULTIPLE CHOICE

[1]. Senyawa 2-metil butanal berisomer dengan:
a. dietileter;
b. etil isopropil eter;
c. 3-pentanol;
d.3-metil 2-butanol;
e. dietil keton.

[2]. Nama senyawa CH3-CH2-COO-CH2-CH2-CH3adalah:
a. propana etana karboksilat;
b. propana etilkarboksilat;
c. etil propil karboksilat;
d. propilpropanoat;
e. propil etanoat.

[3]. Nama senyawa CH3-CH(CH3)-CH(COOH)-CH3yang tidak tepat berikut ini adalah:
a. 2,3-dimetilbutanoat;
b. 2,3-dimetil butirat;
c. 2,3-dimetilpropana karboksilat;
d. 2-metil butana 3-karboksilat;
e.3-metil butana 2-karboksilat.

[4]. Senyawa berikut ini yang tidak dapat berisomeradalah:
a. eter dengan alkohol;
b. alkanal dengan alkanon;
c. alkanoat dengan ester;
d. alkana dengan sikloalkana;
e. alkena dengan sikloalkana.

[5]. Oksidasi suatu alkohol menghasilkan 3-metil butanal. Alkoholtersebut adalah:
a. CH3-(CH2)2-CHOH-CH3;
b. CH3-C(CH3)2-CH2OH;
c. CH3-(CH2)3-CH2OH;
d. (CH3)2-CH-CH2-CH2OH;
e. CH3-CH2-CHOH-CH2-CH3.

[6]. Dari nama senyawa-senyawa berikut yang menunjukkan penamaanyang salah adalah:
a. 2,2-dimetil propana;
b. 3,4-dimetil2-heksanol;
c. 2,3-dimetil pentanal;
d. 2,3-dietil butana;
e.3,3-dimetil 2-butanon.

[7]. Etil asetat berisomer dengan senyawa berikut ini, kecuali:
a. butanoat;
b. metil propanoat;
c. propil metanoat;
d. etil etana karboksilat;
e. 2-metil propanoat.

[8]. Dietil eter dapat dihasilkan dari reaksi:
a. etanoldengan asam sulfat pekat;
b. etanol dengan etanoat;
c.oksidasi 2-butanon;
d. oksidasi 2-butanal;
e. oksidasi2-butanol.

[9]. Suatu senyawa dengan rumus molekul C4H10Omempunyai sifat mudah terbakar, tak dapat dioksidasi, dan denganasam asetat terbentuk ester, maka senyawa tersebut adalah:
a.n-butanol;
b. n-butanal;
c. n-butanon;
d. dietil eter;
e. tersier butil alkohol.

[10]. Penamaan senyawa CH3-CHO(CH3)-CH2-CH3seperti berikut (1) etil isopropil eter, (2) 2-etoksi propana,(3) 2-propoksi etana, (4) etil sekunder propil eter. Penamaanyang benar semuanya terdapat pada: a. 1,2,3,4;
b. 1,2,4;
c. 1,2,3;
d. 1,3,4;
e. 2,3,4.

[11]. Reaksi yang terjadi dari alkanol + alkanoat + H2SO4pekat adalah:
a. ester;
b. etena;
c.dietil eter;
d. dietil keton;
e. alkil alkana sulfat.

[12]. Pada reaksi metil alkohol + asam salisilat, ditambahkanH2SO4 pekat yang maksudnya adalah: a.mengikat air yang terjadi;
b. menggeser kestimbangan reaksi;
c. supaya teroksidasi;
d. mencegah oksidasi;
e. a dan b benar.

[13]. Senyawa yang dapat bereaksi membentuk yodoform denganlarutan I2 dan NaOH adalah:
a. alkanal;
b.alkanol;
c. alkanon;
d. a dan b benar;
e.a, b, dan c benar.

[14]. Senyawa yang dengan pereaksi Tollen akan membentuk cerminperak ialah:
a. formalin;
b. metil alkohol;
c. aseton;
d. a dan b benar;
e. a, b, dan c benar.

[15]. Senyawa yang dengan pereaksi Fehling akan membentuk endapanmerah bata adalah:
a. metanal;
b. metanol;
c. propanon;
d. a dan b benar;
e. a, b, dan c benar.

[16]. Pernyataan yang tepat mengenai larutan Fehling adalah:
a. Fehling A terdiri dari CuSO4, Fehling B terdiridari NaOH dan kalium natrium tartrat;
b. Fehling A terdiridari CuSO4 dan NaOH, Fehling B terdiri dari kaliumnatrium tartrat;
c. Fehling A terdiri dari CuSO4dan kalium natrium tartrat, Fehling B terdiri dari NaOH;
d. Fehling A terdiri dari NaOH dan Cu2O, Fehling B terdiridari NaOH dan kalium natrium tartrat;
e. Fehling A terdiridari Cu2O, Fehling B terdiri dari NaOH dan kalium natriumtartrat;

[17]. Suatu senyawa karbon, dengan K2Cr2O7dan H2SO4 pekat dapat teroksidasi, tetapitidak dapat membentuk endapan merah bata dengan pereaksi Fehling,maka senyawa itu kemungkinan adalah:
a. matanal;
b. metanol;
c. etil alkohol;
d. asetaldehida;
e.aseton.

[18]. Pereaksi Tollen bersifat sebagai berikut:
a. oksidator,mengandung garam perak dalam larutan amonia berlebih;
b.oksidator, mengandung CuO dalam larutan kalium natrium tartrat;
c. reduktor, mengandung garam perak dalam larutan amoniaberlebih;
d. reduktor, mengandung CuO dalam kalium natriumtartrat;
e. reduktor, mengandung senyawa perak dan CuOdalam NaOH.


[19]. Berikut ini campuran senyawa yang merupakan oksidatorkuat yang sering dipakai untuk mengoksidasi senyawa karbon ialah:
a. K2Cr2O7 + H2SO4;
b. KMnO4 + H2SO4;
c.pereaksi Tollen;
d. pereaksi Fehling;
e. a dan b benar.

ESSAY

[1]. Tuliskan dua macam reaksi yang dapat menghasilkan pentanon!

[2]. Gambarkan rumus bangun (struktur) semua isomer yang rumuskimianya C3H8O, tuliskan pula masing-masingnamanya !

[3]. Tuliskan reaksi yang terjadi pada: (a). metanal denganpereaksi Fehling; (b). asetaldehida + NaOH(aq)+I2(KI aq); (c). demetil keton + NaOH(aq)+ I2(KI aq); (d). etil alkohol + NaOH(aq)+ I2(KI aq); (e) formalin dengan pereaksi Tollen;(f). butil alkohol dengan K2Cr2O7+ H2SO4.

Tidak ada komentar:

Poskan Komentar